C16H23NO2 — CID 100664309
methyl 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pentanoate (PubChem CID 100664309) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is methyl 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pentanoate.
| Compound Name | methyl 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pentanoate |
|---|---|
| PubChem CID | 100664309 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | methyl 5-[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]pentanoate |
| SMILES | COC(=O)CCCCN(C)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C16H23NO2/c1-17(12-6-5-9-16(18)19-2)15-11-10-13-7-3-4-8-14(13)15/h3-4,7-8,15H,5-6,9-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | HOSZLPBVIHSVMG-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|