C24H30BrN3O3 — CID 139942235
methyl 4-[3-[(4-bromophenyl)carbamoylamino]propyl-(2,3-dihydro-1H-inden-1-yl)amino]butanoate (PubChem CID 139942235) has the molecular formula C24H30BrN3O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is methyl 4-[3-[(4-bromophenyl)carbamoylamino]propyl-(2,3-dihydro-1H-inden-1-yl)amino]butanoate.
| Compound Name | methyl 4-[3-[(4-bromophenyl)carbamoylamino]propyl-(2,3-dihydro-1H-inden-1-yl)amino]butanoate |
|---|---|
| PubChem CID | 139942235 |
| Molecular Formula | C24H30BrN3O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 4-[3-[(4-bromophenyl)carbamoylamino]propyl-(2,3-dihydro-1H-inden-1-yl)amino]butanoate |
| SMILES | COC(=O)CCCN(CCCNC(=O)Nc1ccc(Br)cc1)C1CCc2ccccc21 |
| InChI | InChI=1S/C24H30BrN3O3/c1-31-23(29)8-4-16-28(22-14-9-18-6-2-3-7-21(18)22)17-5-15-26-24(30)27-20-12-10-19(25)11-13-20/h2-3,6-7,10-13,22H,4-5,8-9,14-17H2,1H3,(H2,26,27,30) |
| InChIKey | COECTZVHZXZLPJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|