C24H31N3O5 — CID 163767170
4-[3-[(4-hydroxyphenyl)carbamoylamino]propyl-(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]butanoic acid (PubChem CID 163767170) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[3-[(4-hydroxyphenyl)carbamoylamino]propyl-(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]butanoic acid.
| Compound Name | 4-[3-[(4-hydroxyphenyl)carbamoylamino]propyl-(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 163767170 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-[3-[(4-hydroxyphenyl)carbamoylamino]propyl-(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]butanoic acid |
| SMILES | COc1ccc2c(c1)C(N(CCCNC(=O)Nc1ccc(O)cc1)CCCC(=O)O)CC2 |
| InChI | InChI=1S/C24H31N3O5/c1-32-20-11-5-17-6-12-22(21(17)16-20)27(14-2-4-23(29)30)15-3-13-25-24(31)26-18-7-9-19(28)10-8-18/h5,7-11,16,22,28H,2-4,6,12-15H2,1H3,(H,29,30)(H2,25,26,31) |
| InChIKey | MDHZQAGGNBPNQX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|