C23H26N2O2 — CID 30344627
2-[4-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butyl]isoindole-1,3-dione (PubChem CID 30344627) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[4-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30344627 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[4-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butyl]isoindole-1,3-dione |
| SMILES | CN(CCCCN1C(=O)c2ccccc2C1=O)[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-24(21-14-8-10-17-9-2-3-11-18(17)21)15-6-7-16-25-22(26)19-12-4-5-13-20(19)23(25)27/h2-5,9,11-13,21H,6-8,10,14-16H2,1H3/t21-/m1/s1 |
| InChIKey | NFESBHPUDKZABY-OAQYLSRUSA-N |
| XLogP | 4.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|