C17H15N — CID 139228300
1-(2,3-dihydro-1H-inden-1-yl)indole (PubChem CID 139228300) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)indole.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)indole |
|---|---|
| PubChem CID | 139228300 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)indole |
| SMILES | c1ccc2c(c1)CCC2n1ccc2ccccc21 |
| InChI | InChI=1S/C17H15N/c1-3-7-15-13(5-1)9-10-17(15)18-12-11-14-6-2-4-8-16(14)18/h1-8,11-12,17H,9-10H2 |
| InChIKey | UIUNHJZJURYZIG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |