C15H17N3 — CID 106562783
1-(2,3-dihydro-1H-inden-1-yl)-N-prop-2-enylimidazol-2-amine (PubChem CID 106562783) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106562783 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1C1CCc2ccccc21 |
| InChI | InChI=1S/C15H17N3/c1-2-9-16-15-17-10-11-18(15)14-8-7-12-5-3-4-6-13(12)14/h2-6,10-11,14H,1,7-9H2,(H,16,17) |
| InChIKey | JMMGVCIIHLSLIG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|