C14H24N4 — CID 106581944
1-[2-(1-methylpiperidin-4-yl)ethyl]-N-prop-2-enylimidazol-2-amine (PubChem CID 106581944) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[2-(1-methylpiperidin-4-yl)ethyl]-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-[2-(1-methylpiperidin-4-yl)ethyl]-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106581944 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-[2-(1-methylpiperidin-4-yl)ethyl]-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1CCC1CCN(C)CC1 |
| InChI | InChI=1S/C14H24N4/c1-3-7-15-14-16-8-12-18(14)11-6-13-4-9-17(2)10-5-13/h3,8,12-13H,1,4-7,9-11H2,2H3,(H,15,16) |
| InChIKey | YXSFWQIXGGGNDO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|