C14H23N3 — CID 106574657
1-(4,4-dimethylcyclohexyl)-N-prop-2-enylimidazol-2-amine (PubChem CID 106574657) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106574657 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H23N3/c1-4-9-15-13-16-10-11-17(13)12-5-7-14(2,3)8-6-12/h4,10-12H,1,5-9H2,2-3H3,(H,15,16) |
| InChIKey | KXGUCYNSJRXTLX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|