C17H29N3 — CID 106574656
N-cyclohexyl-1-(4,4-dimethylcyclohexyl)imidazol-2-amine (PubChem CID 106574656) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N-cyclohexyl-1-(4,4-dimethylcyclohexyl)imidazol-2-amine.
| Compound Name | N-cyclohexyl-1-(4,4-dimethylcyclohexyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106574656 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N-cyclohexyl-1-(4,4-dimethylcyclohexyl)imidazol-2-amine |
| SMILES | CC1(C)CCC(n2ccnc2NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H29N3/c1-17(2)10-8-15(9-11-17)20-13-12-18-16(20)19-14-6-4-3-5-7-14/h12-15H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | NGUCIMCVHQZING-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |