C16H21N3 — CID 106562786
1-butyl-N-(2,3-dihydro-1H-inden-1-yl)imidazol-2-amine (PubChem CID 106562786) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-butyl-N-(2,3-dihydro-1H-inden-1-yl)imidazol-2-amine.
| Compound Name | 1-butyl-N-(2,3-dihydro-1H-inden-1-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106562786 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-butyl-N-(2,3-dihydro-1H-inden-1-yl)imidazol-2-amine |
| SMILES | CCCCn1ccnc1NC1CCc2ccccc21 |
| InChI | InChI=1S/C16H21N3/c1-2-3-11-19-12-10-17-16(19)18-15-9-8-13-6-4-5-7-14(13)15/h4-7,10,12,15H,2-3,8-9,11H2,1H3,(H,17,18) |
| InChIKey | GFMBHQNKKFWFOY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |