C13H20N2 — CID 67763645
1-butyl-2-(2,3-dihydro-1H-inden-1-yl)hydrazine (PubChem CID 67763645) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-butyl-2-(2,3-dihydro-1H-inden-1-yl)hydrazine.
| Compound Name | 1-butyl-2-(2,3-dihydro-1H-inden-1-yl)hydrazine |
|---|---|
| PubChem CID | 67763645 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-butyl-2-(2,3-dihydro-1H-inden-1-yl)hydrazine |
| SMILES | CCCCNNC1CCc2ccccc21 |
| InChI | InChI=1S/C13H20N2/c1-2-3-10-14-15-13-9-8-11-6-4-5-7-12(11)13/h4-7,13-15H,2-3,8-10H2,1H3 |
| InChIKey | WDBHROKCSJRGQW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|