C10H14ClN — CID 18627798
N-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 18627798) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is N-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
| Compound Name | N-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
|---|---|
| PubChem CID | 18627798 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | CNC1CCc2ccccc21.Cl |
| InChI | InChI=1S/C10H13N.ClH/c1-11-10-7-6-8-4-2-3-5-9(8)10;/h2-5,10-11H,6-7H2,1H3;1H |
| InChIKey | KVEVQZVPEWEGEU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |