C10H10N2 — CID 62483491
2,3-dihydro-1H-inden-1-ylcyanamide (PubChem CID 62483491) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-ylcyanamide.
| Compound Name | 2,3-dihydro-1H-inden-1-ylcyanamide |
|---|---|
| PubChem CID | 62483491 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-ylcyanamide |
| SMILES | N#CNC1CCc2ccccc21 |
| InChI | InChI=1S/C10H10N2/c11-7-12-10-6-5-8-3-1-2-4-9(8)10/h1-4,10,12H,5-6H2 |
| InChIKey | RVYCGTBJIDKRIW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|