C11H11N3OS — CID 57031420
1-cyano-3-(2,3-dihydro-1H-inden-1-yl)-1-sulfanylurea (PubChem CID 57031420) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-cyano-3-(2,3-dihydro-1H-inden-1-yl)-1-sulfanylurea.
| Compound Name | 1-cyano-3-(2,3-dihydro-1H-inden-1-yl)-1-sulfanylurea |
|---|---|
| PubChem CID | 57031420 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-cyano-3-(2,3-dihydro-1H-inden-1-yl)-1-sulfanylurea |
| SMILES | N#CN(S)C(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C11H11N3OS/c12-7-14(16)11(15)13-10-6-5-8-3-1-2-4-9(8)10/h1-4,10,16H,5-6H2,(H,13,15) |
| InChIKey | SZPGHORRHRHRIU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|