C17H20N2O2 — CID 95160392
3-[(1S)-2,3-dihydro-1H-inden-1-yl]-1-ethyl-1-(furan-3-ylmethyl)urea (PubChem CID 95160392) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[(1S)-2,3-dihydro-1H-inden-1-yl]-1-ethyl-1-(furan-3-ylmethyl)urea.
| Compound Name | 3-[(1S)-2,3-dihydro-1H-inden-1-yl]-1-ethyl-1-(furan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 95160392 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[(1S)-2,3-dihydro-1H-inden-1-yl]-1-ethyl-1-(furan-3-ylmethyl)urea |
| SMILES | CCN(Cc1ccoc1)C(=O)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(11-13-9-10-21-12-13)17(20)18-16-8-7-14-5-3-4-6-15(14)16/h3-6,9-10,12,16H,2,7-8,11H2,1H3,(H,18,20)/t16-/m0/s1 |
| InChIKey | WKERRVWODBIUKN-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |