C15H26N2O3 — CID 111507357
1-ethyl-1-(furan-3-ylmethyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111507357) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-ethyl-1-(furan-3-ylmethyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-ethyl-1-(furan-3-ylmethyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111507357 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-ethyl-1-(furan-3-ylmethyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CCN(Cc1ccoc1)C(=O)NCC(C)(C)CC(C)O |
| InChI | InChI=1S/C15H26N2O3/c1-5-17(9-13-6-7-20-10-13)14(19)16-11-15(3,4)8-12(2)18/h6-7,10,12,18H,5,8-9,11H2,1-4H3,(H,16,19) |
| InChIKey | LVDHNDDKIHXJMK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |