C18H17N3 — CID 43688255
N-(4-pyrazol-1-ylphenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 43688255) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-(4-pyrazol-1-ylphenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(4-pyrazol-1-ylphenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 43688255 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-(4-pyrazol-1-ylphenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | c1ccc2c(c1)CCC2Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C18H17N3/c1-2-5-17-14(4-1)6-11-18(17)20-15-7-9-16(10-8-15)21-13-3-12-19-21/h1-5,7-10,12-13,18,20H,6,11H2 |
| InChIKey | KBISCPBKJUXWCW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |