C19H23N5O — CID 102438627
(1R,2S)-1-[(9-butylpurin-6-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 102438627) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (1R,2S)-1-[(9-butylpurin-6-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1R,2S)-1-[(9-butylpurin-6-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 102438627 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1R,2S)-1-[(9-butylpurin-6-yl)amino]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CCCCn1cnc2c(N[C@@H]3c4ccccc4CC[C@@H]3O)ncnc21 |
| InChI | InChI=1S/C19H23N5O/c1-2-3-10-24-12-22-17-18(20-11-21-19(17)24)23-16-14-7-5-4-6-13(14)8-9-15(16)25/h4-7,11-12,15-16,25H,2-3,8-10H2,1H3,(H,20,21,23)/t15-,16+/m0/s1 |
| InChIKey | PTBWYVMCGKVOFZ-JKSUJKDBSA-N |
| XLogP | 3.09 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |