C19H24N6O6S — CID 134379158
[(2R)-2-[(1R)-1-[6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]ethoxy]-3,3-dihydroxypropyl] sulfamate (PubChem CID 134379158) has the molecular formula C19H24N6O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is [(2R)-2-[(1R)-1-[6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]ethoxy]-3,3-dihydroxypropyl] sulfamate.
| Compound Name | [(2R)-2-[(1R)-1-[6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]ethoxy]-3,3-dihydroxypropyl] sulfamate |
|---|---|
| PubChem CID | 134379158 |
| Molecular Formula | C19H24N6O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2R)-2-[(1R)-1-[6-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]ethoxy]-3,3-dihydroxypropyl] sulfamate |
| SMILES | C[C@@H](O[C@H](COS(N)(=O)=O)C(O)O)n1cnc2c(N[C@H]3CCc4ccccc43)ncnc21 |
| InChI | InChI=1S/C19H24N6O6S/c1-11(31-15(19(26)27)8-30-32(20,28)29)25-10-23-16-17(21-9-22-18(16)25)24-14-7-6-12-4-2-3-5-13(12)14/h2-5,9-11,14-15,19,26-27H,6-8H2,1H3,(H2,20,28,29)(H,21,22,24)/t11-,14+,15-/m1/s1 |
| InChIKey | DVGLVLPXEUAIBV-BYCMXARLSA-N |
| XLogP | 0.36 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|