C21H24N4O5S — CID 56943977
[(1S,2S,4S)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 56943977) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is [(1S,2S,4S)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4S)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 56943977 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(1S,2S,4S)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@H]1C[C@H](c2coc3c(N[C@H]4CCc5ccccc54)ncnc23)C[C@@H]1O |
| InChI | InChI=1S/C21H24N4O5S/c22-31(27,28)30-9-14-7-13(8-18(14)26)16-10-29-20-19(16)23-11-24-21(20)25-17-6-5-12-3-1-2-4-15(12)17/h1-4,10-11,13-14,17-18,26H,5-9H2,(H2,22,27,28)(H,23,24,25)/t13-,14-,17-,18-/m0/s1 |
| InChIKey | LYLRWPXUNXVMNF-USJZOSNVSA-N |
| XLogP | 2.40 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |