C21H26N6O4S — CID 59671344
[(1S,2S,4R)-2-hydroxy-4-[[8-(1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 59671344) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-[[8-(1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-[[8-(1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671344 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-[[8-(1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@H]1C[C@@H](Nc2ncnc3nc(C4CCCc5ccccc54)[nH]c23)C[C@@H]1O |
| InChI | InChI=1S/C21H26N6O4S/c22-32(29,30)31-10-13-8-14(9-17(13)28)25-20-18-21(24-11-23-20)27-19(26-18)16-7-3-5-12-4-1-2-6-15(12)16/h1-2,4,6,11,13-14,16-17,28H,3,5,7-10H2,(H2,22,29,30)(H2,23,24,25,26,27)/t13-,14+,16?,17-/m0/s1 |
| InChIKey | REBKXEGYOOWGTL-ADNJVRNUSA-N |
| XLogP | 1.59 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |