C14H10Cl2N4 — CID 16733520
2,6-dichloro-7-(2,3-dihydro-1H-inden-1-yl)purine (PubChem CID 16733520) has the molecular formula C14H10Cl2N4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 2,6-dichloro-7-(2,3-dihydro-1H-inden-1-yl)purine.
| Compound Name | 2,6-dichloro-7-(2,3-dihydro-1H-inden-1-yl)purine |
|---|---|
| PubChem CID | 16733520 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2,6-dichloro-7-(2,3-dihydro-1H-inden-1-yl)purine |
| SMILES | Clc1nc(Cl)c2c(ncn2C2CCc3ccccc32)n1 |
| InChI | InChI=1S/C14H10Cl2N4/c15-12-11-13(19-14(16)18-12)17-7-20(11)10-6-5-8-3-1-2-4-9(8)10/h1-4,7,10H,5-6H2 |
| InChIKey | CNIQUKDGHKGQIM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |