C35H31FN2O4 — CID 67754258
4-[2-[[(E)-3-[1-[(2-fluorophenyl)-phenylmethyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 67754258) has the molecular formula C35H31FN2O4 and a molecular weight of 562.64 g/mol. Its IUPAC name is 4-[2-[[(E)-3-[1-[(2-fluorophenyl)-phenylmethyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-[1-[(2-fluorophenyl)-phenylmethyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67754258 |
| Molecular Formula | C35H31FN2O4 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 4-[2-[[(E)-3-[1-[(2-fluorophenyl)-phenylmethyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | C/C(=C\C(=O)Nc1ccccc1OCCCC(=O)O)c1ccc2c(ccn2C(c2ccccc2)c2ccccc2F)c1 |
| InChI | InChI=1S/C35H31FN2O4/c1-24(22-33(39)37-30-14-7-8-15-32(30)42-21-9-16-34(40)41)26-17-18-31-27(23-26)19-20-38(31)35(25-10-3-2-4-11-25)28-12-5-6-13-29(28)36/h2-8,10-15,17-20,22-23,35H,9,16,21H2,1H3,(H,37,39)(H,40,41)/b24-22+ |
| InChIKey | SNIMFFUSHSFBQJ-ZNTNEXAZSA-N |
| XLogP | 7.70 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|