C35H40N2O4 — CID 10325329
ethyl 4-[2-[[(E)-3-[1-(1-phenylpentyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate (PubChem CID 10325329) has the molecular formula C35H40N2O4 and a molecular weight of 552.72 g/mol. Its IUPAC name is ethyl 4-[2-[[(E)-3-[1-(1-phenylpentyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[[(E)-3-[1-(1-phenylpentyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 10325329 |
| Molecular Formula | C35H40N2O4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | ethyl 4-[2-[[(E)-3-[1-(1-phenylpentyl)indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate |
| SMILES | CCCCC(c1ccccc1)n1ccc2cc(/C(C)=C/C(=O)Nc3ccccc3OCCCC(=O)OCC)ccc21 |
| InChI | InChI=1S/C35H40N2O4/c1-4-6-16-31(27-13-8-7-9-14-27)37-22-21-29-25-28(19-20-32(29)37)26(3)24-34(38)36-30-15-10-11-17-33(30)41-23-12-18-35(39)40-5-2/h7-11,13-15,17,19-22,24-25,31H,4-6,12,16,18,23H2,1-3H3,(H,36,38)/b26-24+ |
| InChIKey | YBUXFKBMOOWIMR-SHHOIMCASA-N |
| XLogP | 8.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|