C37H35FN2O4 — CID 11758142
ethyl 4-[2-[[(E)-3-(1-benzhydrylindol-5-yl)but-2-enoyl]amino]-6-fluorophenoxy]butanoate (PubChem CID 11758142) has the molecular formula C37H35FN2O4 and a molecular weight of 590.70 g/mol. Its IUPAC name is ethyl 4-[2-[[(E)-3-(1-benzhydrylindol-5-yl)but-2-enoyl]amino]-6-fluorophenoxy]butanoate.
| Compound Name | ethyl 4-[2-[[(E)-3-(1-benzhydrylindol-5-yl)but-2-enoyl]amino]-6-fluorophenoxy]butanoate |
|---|---|
| PubChem CID | 11758142 |
| Molecular Formula | C37H35FN2O4 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | ethyl 4-[2-[[(E)-3-(1-benzhydrylindol-5-yl)but-2-enoyl]amino]-6-fluorophenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1c(F)cccc1NC(=O)/C=C(\C)c1ccc2c(ccn2C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H35FN2O4/c1-3-43-35(42)18-11-23-44-37-31(38)16-10-17-32(37)39-34(41)24-26(2)29-19-20-33-30(25-29)21-22-40(33)36(27-12-6-4-7-13-27)28-14-8-5-9-15-28/h4-10,12-17,19-22,24-25,36H,3,11,18,23H2,1-2H3,(H,39,41)/b26-24+ |
| InChIKey | RACFRDOOENPCMI-SHHOIMCASA-N |
| XLogP | 8.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|