C27H22F3NO2 — CID 67753810
3-methyl-4-[1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]but-2-enoic acid (PubChem CID 67753810) has the molecular formula C27H22F3NO2 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-methyl-4-[1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]but-2-enoic acid.
| Compound Name | 3-methyl-4-[1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 67753810 |
| Molecular Formula | C27H22F3NO2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-methyl-4-[1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]indol-5-yl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)Cc1ccc2c(ccn2C(c2ccccc2)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H22F3NO2/c1-18(16-25(32)33)15-19-7-12-24-22(17-19)13-14-31(24)26(20-5-3-2-4-6-20)21-8-10-23(11-9-21)27(28,29)30/h2-14,16-17,26H,15H2,1H3,(H,32,33) |
| InChIKey | BXHZZVNPNVSHJI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|