C28H26F3NO2 — CID 153324642
3-[4-methyl-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]pentyl]benzoic acid (PubChem CID 153324642) has the molecular formula C28H26F3NO2 and a molecular weight of 465.52 g/mol. Its IUPAC name is 3-[4-methyl-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]pentyl]benzoic acid.
| Compound Name | 3-[4-methyl-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 153324642 |
| Molecular Formula | C28H26F3NO2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-[4-methyl-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]pentyl]benzoic acid |
| SMILES | CC(C)CCC(c1cccc(C(=O)O)c1)n1ccc2cc(-c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C28H26F3NO2/c1-18(2)6-12-25(21-4-3-5-23(17-21)27(33)34)32-15-14-22-16-20(9-13-26(22)32)19-7-10-24(11-8-19)28(29,30)31/h3-5,7-11,13-18,25H,6,12H2,1-2H3,(H,33,34) |
| InChIKey | DTPDWFKLLWCMTL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |