C34H28ClF3N2O3 — CID 153324643
[[4-[3-(4-chlorophenyl)-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]propyl]benzoyl]amino] propanoate (PubChem CID 153324643) has the molecular formula C34H28ClF3N2O3 and a molecular weight of 605.06 g/mol. Its IUPAC name is [[4-[3-(4-chlorophenyl)-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]propyl]benzoyl]amino] propanoate.
| Compound Name | [[4-[3-(4-chlorophenyl)-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]propyl]benzoyl]amino] propanoate |
|---|---|
| PubChem CID | 153324643 |
| Molecular Formula | C34H28ClF3N2O3 |
| Molecular Weight | 605.06 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | [[4-[3-(4-chlorophenyl)-1-[5-[4-(trifluoromethyl)phenyl]indol-1-yl]propyl]benzoyl]amino] propanoate |
| SMILES | CCC(=O)ONC(=O)c1ccc(C(CCc2ccc(Cl)cc2)n2ccc3cc(-c4ccc(C(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C34H28ClF3N2O3/c1-2-32(41)43-39-33(42)25-8-6-24(7-9-25)30(17-5-22-3-15-29(35)16-4-22)40-20-19-27-21-26(12-18-31(27)40)23-10-13-28(14-11-23)34(36,37)38/h3-4,6-16,18-21,30H,2,5,17H2,1H3,(H,39,42) |
| InChIKey | LFFWDMNVEDRUHA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.06 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|