C27H23F3N2 — CID 21468877
2-[1-[1-[4-(trifluoromethyl)phenyl]pentyl]indol-5-yl]benzonitrile (PubChem CID 21468877) has the molecular formula C27H23F3N2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 2-[1-[1-[4-(trifluoromethyl)phenyl]pentyl]indol-5-yl]benzonitrile.
| Compound Name | 2-[1-[1-[4-(trifluoromethyl)phenyl]pentyl]indol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 21468877 |
| Molecular Formula | C27H23F3N2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[1-[1-[4-(trifluoromethyl)phenyl]pentyl]indol-5-yl]benzonitrile |
| SMILES | CCCCC(c1ccc(C(F)(F)F)cc1)n1ccc2cc(-c3ccccc3C#N)ccc21 |
| InChI | InChI=1S/C27H23F3N2/c1-2-3-8-25(19-9-12-23(13-10-19)27(28,29)30)32-16-15-21-17-20(11-14-26(21)32)24-7-5-4-6-22(24)18-31/h4-7,9-17,25H,2-3,8H2,1H3 |
| InChIKey | YCRVPYZMIVALKD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |