C27H25NO3 — CID 67754291
4-[1-[(4-methoxyphenyl)-phenylmethyl]indol-5-yl]-3-methylbut-2-enoic acid (PubChem CID 67754291) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[1-[(4-methoxyphenyl)-phenylmethyl]indol-5-yl]-3-methylbut-2-enoic acid.
| Compound Name | 4-[1-[(4-methoxyphenyl)-phenylmethyl]indol-5-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 67754291 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[1-[(4-methoxyphenyl)-phenylmethyl]indol-5-yl]-3-methylbut-2-enoic acid |
| SMILES | COc1ccc(C(c2ccccc2)n2ccc3cc(CC(C)=CC(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C27H25NO3/c1-19(17-26(29)30)16-20-8-13-25-23(18-20)14-15-28(25)27(21-6-4-3-5-7-21)22-9-11-24(31-2)12-10-22/h3-15,17-18,27H,16H2,1-2H3,(H,29,30) |
| InChIKey | OFIFVOCKEBLILA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|