C20H18FNO2 — CID 67753951
4-[1-[(4-fluorophenyl)methyl]indol-5-yl]-3-methylbut-2-enoic acid (PubChem CID 67753951) has the molecular formula C20H18FNO2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]indol-5-yl]-3-methylbut-2-enoic acid.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]indol-5-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 67753951 |
| Molecular Formula | C20H18FNO2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]indol-5-yl]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)Cc1ccc2c(ccn2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H18FNO2/c1-14(11-20(23)24)10-16-4-7-19-17(12-16)8-9-22(19)13-15-2-5-18(21)6-3-15/h2-9,11-12H,10,13H2,1H3,(H,23,24) |
| InChIKey | XHSVXUNODJNSAY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|