C17H16FN5 — CID 168592291
2-[[1-[(4-fluorophenyl)methyl]indol-5-yl]methylideneamino]guanidine (PubChem CID 168592291) has the molecular formula C17H16FN5 and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[[1-[(4-fluorophenyl)methyl]indol-5-yl]methylideneamino]guanidine.
| Compound Name | 2-[[1-[(4-fluorophenyl)methyl]indol-5-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592291 |
| Molecular Formula | C17H16FN5 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[[1-[(4-fluorophenyl)methyl]indol-5-yl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc2c(ccn2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16FN5/c18-15-4-1-12(2-5-15)11-23-8-7-14-9-13(3-6-16(14)23)10-21-22-17(19)20/h1-10H,11H2,(H4,19,20,22) |
| InChIKey | GVKHINUSKOLAAU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|