C26H29NO7 — CID 69072292
ethyl 4-[[2-[4-(3,4-dimethoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoate (PubChem CID 69072292) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(3,4-dimethoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoate.
| Compound Name | ethyl 4-[[2-[4-(3,4-dimethoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoate |
|---|---|
| PubChem CID | 69072292 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 4-[[2-[4-(3,4-dimethoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cccc2cc(C(C)=CC(=O)Nc3ccc(OC)c(OC)c3)oc12 |
| InChI | InChI=1S/C26H29NO7/c1-5-32-25(29)10-7-13-33-21-9-6-8-18-15-22(34-26(18)21)17(2)14-24(28)27-19-11-12-20(30-3)23(16-19)31-4/h6,8-9,11-12,14-16H,5,7,10,13H2,1-4H3,(H,27,28) |
| InChIKey | FHJIMMIOIQJBRT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|