C22H25N3O4 — CID 122550278
ethyl 4-[2-methoxy-5-[(2-methylquinazolin-4-yl)amino]phenoxy]butanoate (PubChem CID 122550278) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-5-[(2-methylquinazolin-4-yl)amino]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-methoxy-5-[(2-methylquinazolin-4-yl)amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 122550278 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl 4-[2-methoxy-5-[(2-methylquinazolin-4-yl)amino]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(Nc2nc(C)nc3ccccc23)ccc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-4-28-21(26)10-7-13-29-20-14-16(11-12-19(20)27-3)25-22-17-8-5-6-9-18(17)23-15(2)24-22/h5-6,8-9,11-12,14H,4,7,10,13H2,1-3H3,(H,23,24,25) |
| InChIKey | UHIOKBIIWZAGBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|