C23H23NO6 — CID 69076339
4-[[2-[4-(4-methoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid (PubChem CID 69076339) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-[[2-[4-(4-methoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid.
| Compound Name | 4-[[2-[4-(4-methoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 69076339 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[[2-[4-(4-methoxyanilino)-4-oxobut-2-en-2-yl]-1-benzofuran-7-yl]oxy]butanoic acid |
| SMILES | COc1ccc(NC(=O)C=C(C)c2cc3cccc(OCCCC(=O)O)c3o2)cc1 |
| InChI | InChI=1S/C23H23NO6/c1-15(13-21(25)24-17-8-10-18(28-2)11-9-17)20-14-16-5-3-6-19(23(16)30-20)29-12-4-7-22(26)27/h3,5-6,8-11,13-14H,4,7,12H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | OCVGLNSAGCWKMD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|