C20H18O4 — CID 57454662
(Z)-3-[7-(1-phenylethoxy)-1-benzofuran-2-yl]but-2-enoic acid (PubChem CID 57454662) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (Z)-3-[7-(1-phenylethoxy)-1-benzofuran-2-yl]but-2-enoic acid.
| Compound Name | (Z)-3-[7-(1-phenylethoxy)-1-benzofuran-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 57454662 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (Z)-3-[7-(1-phenylethoxy)-1-benzofuran-2-yl]but-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)c1cc2cccc(OC(C)c3ccccc3)c2o1 |
| InChI | InChI=1S/C20H18O4/c1-13(11-19(21)22)18-12-16-9-6-10-17(20(16)24-18)23-14(2)15-7-4-3-5-8-15/h3-12,14H,1-2H3,(H,21,22)/b13-11- |
| InChIKey | DRFBCBSGUXCLGD-QBFSEMIESA-N |
| XLogP | 5.06 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|