C25H38O — CID 142051706
1-[(2Z,4E,6E)-3,6-dimethylocta-2,4,6-trien-2-yl]-3,5-di(propan-2-yl)-2-propoxybenzene (PubChem CID 142051706) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-[(2Z,4E,6E)-3,6-dimethylocta-2,4,6-trien-2-yl]-3,5-di(propan-2-yl)-2-propoxybenzene.
| Compound Name | 1-[(2Z,4E,6E)-3,6-dimethylocta-2,4,6-trien-2-yl]-3,5-di(propan-2-yl)-2-propoxybenzene |
|---|---|
| PubChem CID | 142051706 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | 1-[(2Z,4E,6E)-3,6-dimethylocta-2,4,6-trien-2-yl]-3,5-di(propan-2-yl)-2-propoxybenzene |
| SMILES | C/C=C(C)/C=C/C(C)=C(/C)c1cc(C(C)C)cc(C(C)C)c1OCCC |
| InChI | InChI=1S/C25H38O/c1-10-14-26-25-23(18(5)6)15-22(17(3)4)16-24(25)21(9)20(8)13-12-19(7)11-2/h11-13,15-18H,10,14H2,1-9H3/b13-12+,19-11+,21-20- |
| InChIKey | GMOSNJZTDBYFND-WGLWRALUSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|