C22H38O3 — CID 59782939
1,3,5-tri(propan-2-yl)-2-[2-(1-propan-2-yloxyethoxy)ethoxy]benzene (PubChem CID 59782939) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 1,3,5-tri(propan-2-yl)-2-[2-(1-propan-2-yloxyethoxy)ethoxy]benzene.
| Compound Name | 1,3,5-tri(propan-2-yl)-2-[2-(1-propan-2-yloxyethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 59782939 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 1,3,5-tri(propan-2-yl)-2-[2-(1-propan-2-yloxyethoxy)ethoxy]benzene |
| SMILES | CC(C)OC(C)OCCOc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C22H38O3/c1-14(2)19-12-20(15(3)4)22(21(13-19)16(5)6)24-11-10-23-18(9)25-17(7)8/h12-18H,10-11H2,1-9H3 |
| InChIKey | ZBXLFKAMYGYTGO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|