C28H42O3 — CID 142051699
(2E,4E)-5-[2-[2-butoxy-6-methyl-3,5-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 142051699) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2E,4E)-5-[2-[2-butoxy-6-methyl-3,5-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[2-[2-butoxy-6-methyl-3,5-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142051699 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2E,4E)-5-[2-[2-butoxy-6-methyl-3,5-di(propan-2-yl)cyclohexa-2,4-dien-1-yl]cyclopenten-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCCOC1=C(C(C)C)C=C(C(C)C)C(C)C1C1=C(/C=C/C(C)=C/C(=O)O)CCC1 |
| InChI | InChI=1S/C28H42O3/c1-8-9-15-31-28-25(19(4)5)17-24(18(2)3)21(7)27(28)23-12-10-11-22(23)14-13-20(6)16-26(29)30/h13-14,16-19,21,27H,8-12,15H2,1-7H3,(H,29,30)/b14-13+,20-16+ |
| InChIKey | DWNZEMHOLGWACF-ZWWNTAHPSA-N |
| XLogP | 7.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|