C23H34O2 — CID 74394436
9-(2-butyl-6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 74394436) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 9-(2-butyl-6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | 9-(2-butyl-6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 74394436 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 9-(2-butyl-6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CCCCC1=C(C=CC(C)=CC=CC(C)=CC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H34O2/c1-6-7-12-20-13-9-16-23(4,5)21(20)15-14-18(2)10-8-11-19(3)17-22(24)25/h8,10-11,14-15,17H,6-7,9,12-13,16H2,1-5H3,(H,24,25) |
| InChIKey | QZTGWEZSZARWSX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|