C20H27FO2 — CID 88729791
(2Z,4E,6E,8E)-3-(fluoromethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (PubChem CID 88729791) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-3-(fluoromethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | (2Z,4E,6E,8E)-3-(fluoromethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 88729791 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2Z,4E,6E,8E)-3-(fluoromethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(=C/C(=O)O)CF)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H27FO2/c1-15(7-5-9-17(14-21)13-19(22)23)10-11-18-16(2)8-6-12-20(18,3)4/h5,7,9-11,13H,6,8,12,14H2,1-4H3,(H,22,23)/b9-5+,11-10+,15-7+,17-13- |
| InChIKey | BOUGAMLZSPMNOJ-ZUYBZRKMSA-N |
| XLogP | 5.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|