C27H34O3S — CID 21136500
(2E,4E)-5-[3-(3-cyclohexyl-5-ethyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 21136500) has the molecular formula C27H34O3S and a molecular weight of 438.63 g/mol. Its IUPAC name is (2E,4E)-5-[3-(3-cyclohexyl-5-ethyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[3-(3-cyclohexyl-5-ethyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 21136500 |
| Molecular Formula | C27H34O3S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2E,4E)-5-[3-(3-cyclohexyl-5-ethyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCOc1c(-c2ccsc2/C=C/C(C)=C/C(=O)O)cc(CC)cc1C1CCCCC1 |
| InChI | InChI=1S/C27H34O3S/c1-4-14-30-27-23(21-9-7-6-8-10-21)17-20(5-2)18-24(27)22-13-15-31-25(22)12-11-19(3)16-26(28)29/h11-13,15-18,21H,4-10,14H2,1-3H3,(H,28,29)/b12-11+,19-16+ |
| InChIKey | GTJNCAGJJYWUFL-NXOKQZBISA-N |
| XLogP | 7.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|