C26H32F2O3S — CID 11730257
ethyl (2E,4E)-5-[3-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-ethylphenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoate (PubChem CID 11730257) has the molecular formula C26H32F2O3S and a molecular weight of 462.60 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[3-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-ethylphenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[3-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-ethylphenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11730257 |
| Molecular Formula | C26H32F2O3S |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | ethyl (2E,4E)-5-[3-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-ethylphenyl]thiophen-2-yl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/c1sccc1-c1cc(CC)cc(C(C)(C)C)c1OCC(F)F |
| InChI | InChI=1S/C26H32F2O3S/c1-7-18-14-20(25(31-16-23(27)28)21(15-18)26(4,5)6)19-11-12-32-22(19)10-9-17(3)13-24(29)30-8-2/h9-15,23H,7-8,16H2,1-6H3/b10-9+,17-13+ |
| InChIKey | MXVZJRIITMHETQ-QDNZWQKDSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|