C27H29F3O3S — CID 69218068
ethyl (Z)-3-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoate (PubChem CID 69218068) has the molecular formula C27H29F3O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 69218068 |
| Molecular Formula | C27H29F3O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | ethyl (Z)-3-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)c1cc2c(-c3cc(C)cc(C(C)(C)C)c3OCC(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C27H29F3O3S/c1-7-32-24(31)13-17(3)23-14-19-18(9-8-10-22(19)34-23)20-11-16(2)12-21(26(4,5)6)25(20)33-15-27(28,29)30/h8-14H,7,15H2,1-6H3/b17-13- |
| InChIKey | JMSXHTPKQMPPTE-LGMDPLHJSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|