C21H18F6O3 — CID 10502839
ethyl (E)-3-[3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enoate (PubChem CID 10502839) has the molecular formula C21H18F6O3 and a molecular weight of 432.36 g/mol. Its IUPAC name is ethyl (E)-3-[3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 10502839 |
| Molecular Formula | C21H18F6O3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | ethyl (E)-3-[3-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1cccc(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H18F6O3/c1-3-29-19(28)7-13(2)15-6-4-5-14(8-15)12-30-18-10-16(20(22,23)24)9-17(11-18)21(25,26)27/h4-11H,3,12H2,1-2H3/b13-7+ |
| InChIKey | YOALPEHHDYYCPV-NTUHNPAUSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|