C28H24F3N3O3 — CID 76579320
ethyl 3-(4-methyl-1,2,4-triazol-3-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]prop-2-enoate (PubChem CID 76579320) has the molecular formula C28H24F3N3O3 and a molecular weight of 507.51 g/mol. Its IUPAC name is ethyl 3-(4-methyl-1,2,4-triazol-3-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-(4-methyl-1,2,4-triazol-3-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76579320 |
| Molecular Formula | C28H24F3N3O3 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | ethyl 3-(4-methyl-1,2,4-triazol-3-yl)-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1nncn1C |
| InChI | InChI=1S/C28H24F3N3O3/c1-3-36-26(35)16-25(27-33-32-18-34(27)2)21-9-13-24(14-10-21)37-17-19-5-4-6-22(15-19)20-7-11-23(12-8-20)28(29,30)31/h4-16,18H,3,17H2,1-2H3 |
| InChIKey | WGAVFNDMVAHHLN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|