C21H18F6O3 — CID 86624036
ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylbut-2-enoate (PubChem CID 86624036) has the molecular formula C21H18F6O3 and a molecular weight of 432.36 g/mol. Its IUPAC name is ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylbut-2-enoate.
| Compound Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylbut-2-enoate |
|---|---|
| PubChem CID | 86624036 |
| Molecular Formula | C21H18F6O3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | ethyl 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-phenylbut-2-enoate |
| SMILES | CCOC(=O)C=C(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H18F6O3/c1-2-30-19(28)10-16(15-6-4-3-5-7-15)13-29-12-14-8-17(20(22,23)24)11-18(9-14)21(25,26)27/h3-11H,2,12-13H2,1H3 |
| InChIKey | MUWBOXUFOFBJIL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|