C28H38O3S — CID 85041395
5-[3-(3-tert-butyl-5-pentyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 85041395) has the molecular formula C28H38O3S and a molecular weight of 454.68 g/mol. Its IUPAC name is 5-[3-(3-tert-butyl-5-pentyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[3-(3-tert-butyl-5-pentyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 85041395 |
| Molecular Formula | C28H38O3S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 5-[3-(3-tert-butyl-5-pentyl-2-propoxyphenyl)thiophen-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCCCc1cc(-c2ccsc2C=CC(C)=CC(=O)O)c(OCCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H38O3S/c1-7-9-10-11-21-18-23(27(31-15-8-2)24(19-21)28(4,5)6)22-14-16-32-25(22)13-12-20(3)17-26(29)30/h12-14,16-19H,7-11,15H2,1-6H3,(H,29,30) |
| InChIKey | KTWDMPHBFWZPJT-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|