C25H27F2NO3 — CID 85041146
7-[2-(2,2-difluoroethoxy)-3-propan-2-yl-5-pyridin-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 85041146) has the molecular formula C25H27F2NO3 and a molecular weight of 427.49 g/mol. Its IUPAC name is 7-[2-(2,2-difluoroethoxy)-3-propan-2-yl-5-pyridin-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-[2-(2,2-difluoroethoxy)-3-propan-2-yl-5-pyridin-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 85041146 |
| Molecular Formula | C25H27F2NO3 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 7-[2-(2,2-difluoroethoxy)-3-propan-2-yl-5-pyridin-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(C=CC=C(C)c1cc(-c2ccccn2)cc(C(C)C)c1OCC(F)F)=CC(=O)O |
| InChI | InChI=1S/C25H27F2NO3/c1-16(2)20-13-19(22-10-5-6-11-28-22)14-21(25(20)31-15-23(26)27)18(4)9-7-8-17(3)12-24(29)30/h5-14,16,23H,15H2,1-4H3,(H,29,30) |
| InChIKey | TXJAWZLACMDRMT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|