C22H19F3O4S — CID 70293178
4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 70293178) has the molecular formula C22H19F3O4S and a molecular weight of 436.45 g/mol. Its IUPAC name is 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 70293178 |
| Molecular Formula | C22H19F3O4S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyl)-6H-naphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)CC=C(S(=O)(=O)C(F)(F)F)c2cc(/C=C/c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H19F3O4S/c1-21(2)12-11-19(30(28,29)22(23,24)25)17-13-15(7-10-18(17)21)4-3-14-5-8-16(9-6-14)20(26)27/h3-11,13H,12H2,1-2H3,(H,26,27)/b4-3+ |
| InChIKey | YLYNVLOTSSEZMT-ONEGZZNKSA-N |
| XLogP | 5.51 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|